C18H22O3 — CID 10016854
(E,17S)-17-hydroxyoctadec-15-en-9,11,13-triynoic acid (PubChem CID 10016854) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is (E,17S)-17-hydroxyoctadec-15-en-9,11,13-triynoic acid.
| Compound Name | (E,17S)-17-hydroxyoctadec-15-en-9,11,13-triynoic acid |
|---|---|
| PubChem CID | 10016854 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (E,17S)-17-hydroxyoctadec-15-en-9,11,13-triynoic acid |
| SMILES | C[C@H](O)/C=C/C#CC#CC#CCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H22O3/c1-17(19)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18(20)21/h13,15,17,19H,4,6,8,10,12,14,16H2,1H3,(H,20,21)/b15-13+/t17-/m0/s1 |
| InChIKey | UQORHUYKZNBNLF-VOGRQWBCSA-N |
| XLogP | 2.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|