About 2-fluoroethyl carbonochloridate
2-fluoroethyl carbonochloridate (PubChem CID 10017) has the molecular formula C3H4ClFO2
and a molecular weight of 126.51 g/mol. Its IUPAC name is 2-fluoroethyl carbonochloridate.
Molecular Properties
| Compound Name | 2-fluoroethyl carbonochloridate |
| PubChem CID | 10017 |
| Molecular Formula | C3H4ClFO2 |
| Molecular Weight | 126.51 g/mol |
| Exact Mass | 125.99 |
| IUPAC Name | 2-fluoroethyl carbonochloridate |
| SMILES | O=C(Cl)OCCF |
| InChI | InChI=1S/C3H4ClFO2/c4-3(6)7-2-1-5/h1-2H2 |
| InChIKey | FOHSVPIFZASOED-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.51 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroethyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl carbonochloridate?
The IUPAC name of 2-fluoroethyl carbonochloridate (CID 10017) is 2-fluoroethyl carbonochloridate.
What is the SMILES notation for 2-fluoroethyl carbonochloridate?
The canonical SMILES for 2-fluoroethyl carbonochloridate is O=C(Cl)OCCF.
What is the InChIKey of 2-fluoroethyl carbonochloridate?
The InChIKey is FOHSVPIFZASOED-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4ClFO2/c4-3(6)7-2-1-5/h1-2H2.
What are the key properties of 2-fluoroethyl carbonochloridate?
2-fluoroethyl carbonochloridate has a molecular weight of 126.51 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl carbonochloridate is sourced from PubChem (CID 10017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).