About 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole
3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole (PubChem CID 10017062) has the molecular formula C19H19N3
and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole.
Molecular Properties
| Compound Name | 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole |
| PubChem CID | 10017062 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole |
| SMILES | CCn1c2ccccc2c2cc(-c3nc(C)c(C)[nH]3)ccc21 |
| InChI | InChI=1S/C19H19N3/c1-4-22-17-8-6-5-7-15(17)16-11-14(9-10-18(16)22)19-20-12(2)13(3)21-19/h5-11H,4H2,1-3H3,(H,20,21) |
| InChIKey | QEAFDAIQRSTVCT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole?
The IUPAC name of 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole (CID 10017062) is 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole.
What is the SMILES notation for 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole?
The canonical SMILES for 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole is CCn1c2ccccc2c2cc(-c3nc(C)c(C)[nH]3)ccc21.
What is the InChIKey of 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole?
The InChIKey is QEAFDAIQRSTVCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3/c1-4-22-17-8-6-5-7-15(17)16-11-14(9-10-18(16)22)19-20-12(2)13(3)21-19/h5-11H,4H2,1-3H3,(H,20,21).
What are the key properties of 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole?
3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole has a molecular weight of 289.38 g/mol, XLogP of 4.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethyl-1H-imidazol-2-yl)-9-ethylcarbazole is sourced from PubChem (CID 10017062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).