C17H25NO3 — CID 10017176
(1S,9S,11S)-4,5-dimethoxy-N,N,1-trimethyl-13-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-amine (PubChem CID 10017176) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (1S,9S,11S)-4,5-dimethoxy-N,N,1-trimethyl-13-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-amine.
| Compound Name | (1S,9S,11S)-4,5-dimethoxy-N,N,1-trimethyl-13-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-amine |
|---|---|
| PubChem CID | 10017176 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (1S,9S,11S)-4,5-dimethoxy-N,N,1-trimethyl-13-oxatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-amine |
| SMILES | COc1cc2c(cc1OC)[C@]1(C)C[C@@H](N(C)C)C[C@H](C2)O1 |
| InChI | InChI=1S/C17H25NO3/c1-17-10-12(18(2)3)8-13(21-17)6-11-7-15(19-4)16(20-5)9-14(11)17/h7,9,12-13H,6,8,10H2,1-5H3/t12-,13-,17-/m0/s1 |
| InChIKey | OBEVWUQPBAVSPE-DCGLDWPTSA-N |
| XLogP | 2.58 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |