C18H17NO3 — CID 10017392
2-[(4S,5S)-4-benzyl-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]acetic acid (PubChem CID 10017392) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[(4S,5S)-4-benzyl-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]acetic acid.
| Compound Name | 2-[(4S,5S)-4-benzyl-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 10017392 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[(4S,5S)-4-benzyl-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1OC(c2ccccc2)=N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H17NO3/c20-17(21)12-16-15(11-13-7-3-1-4-8-13)19-18(22-16)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,20,21)/t15-,16-/m0/s1 |
| InChIKey | WBSSFMWWXJQDBL-HOTGVXAUSA-N |
| XLogP | 2.92 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |