C16H27O3P — CID 10017574
[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphonic acid (PubChem CID 10017574) has the molecular formula C16H27O3P and a molecular weight of 298.36 g/mol. Its IUPAC name is [(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphonic acid.
| Compound Name | [(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphonic acid |
|---|---|
| PubChem CID | 10017574 |
| Molecular Formula | C16H27O3P |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/P(=O)(O)O |
| InChI | InChI=1S/C16H27O3P/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-20(17,18)19/h7-8,10,12-13H,5-6,9,11H2,1-4H3,(H2,17,18,19)/b13-7+,15-10+,16-12+ |
| InChIKey | WNZPYILQRZJHHZ-YKXWRRLFSA-N |
| XLogP | 5.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|