About ethyl 3-oxohexadecanoate
ethyl 3-oxohexadecanoate (PubChem CID 10017596) has the molecular formula C18H34O3
and a molecular weight of 298.47 g/mol. Its IUPAC name is ethyl 3-oxohexadecanoate.
Molecular Properties
| Compound Name | ethyl 3-oxohexadecanoate |
| PubChem CID | 10017596 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | ethyl 3-oxohexadecanoate |
| SMILES | CCCCCCCCCCCCCC(=O)CC(=O)OCC |
| InChI | InChI=1S/C18H34O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18(20)21-4-2/h3-16H2,1-2H3 |
| InChIKey | PXZGIZYCPLIFIX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxohexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxohexadecanoate?
The IUPAC name of ethyl 3-oxohexadecanoate (CID 10017596) is ethyl 3-oxohexadecanoate.
What is the SMILES notation for ethyl 3-oxohexadecanoate?
The canonical SMILES for ethyl 3-oxohexadecanoate is CCCCCCCCCCCCCC(=O)CC(=O)OCC.
What is the InChIKey of ethyl 3-oxohexadecanoate?
The InChIKey is PXZGIZYCPLIFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18(20)21-4-2/h3-16H2,1-2H3.
What are the key properties of ethyl 3-oxohexadecanoate?
ethyl 3-oxohexadecanoate has a molecular weight of 298.47 g/mol, XLogP of 5.21, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxohexadecanoate is sourced from PubChem (CID 10017596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).