C15H24O6 — CID 10017667
[(3R,4S,5R)-3-hydroxy-8-oxo-1,7-dioxaspiro[4.4]nonan-4-yl] octanoate (PubChem CID 10017667) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is [(3R,4S,5R)-3-hydroxy-8-oxo-1,7-dioxaspiro[4.4]nonan-4-yl] octanoate.
| Compound Name | [(3R,4S,5R)-3-hydroxy-8-oxo-1,7-dioxaspiro[4.4]nonan-4-yl] octanoate |
|---|---|
| PubChem CID | 10017667 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(3R,4S,5R)-3-hydroxy-8-oxo-1,7-dioxaspiro[4.4]nonan-4-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1[C@H](O)CO[C@]12COC(=O)C2 |
| InChI | InChI=1S/C15H24O6/c1-2-3-4-5-6-7-12(17)21-14-11(16)9-20-15(14)8-13(18)19-10-15/h11,14,16H,2-10H2,1H3/t11-,14+,15-/m1/s1 |
| InChIKey | HICRIPRTFAOBSR-BYCMXARLSA-N |
| XLogP | 1.34 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|