C17H19NO2S — CID 10017753
(1R,13S,18S)-15-methylsulfanyl-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9,16-tetraene (PubChem CID 10017753) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is (1R,13S,18S)-15-methylsulfanyl-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9,16-tetraene.
| Compound Name | (1R,13S,18S)-15-methylsulfanyl-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9,16-tetraene |
|---|---|
| PubChem CID | 10017753 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (1R,13S,18S)-15-methylsulfanyl-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.013,18]nonadeca-2,4(8),9,16-tetraene |
| SMILES | CSC1C=C[C@H]2[C@H]3CN(Cc4cc5c(cc43)OCO5)[C@H]2C1 |
| InChI | InChI=1S/C17H19NO2S/c1-21-11-2-3-12-14-8-18(15(12)5-11)7-10-4-16-17(6-13(10)14)20-9-19-16/h2-4,6,11-12,14-15H,5,7-9H2,1H3/t11?,12-,14+,15-/m0/s1 |
| InChIKey | MOVMKEFXBGEPTD-IQVOKHDLSA-N |
| XLogP | 3.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|