C14H26N2O5 — CID 10017802
tert-butyl (4S,5R)-4-[methoxy(methyl)carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10017802) has the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-[methoxy(methyl)carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-[methoxy(methyl)carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10017802 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | tert-butyl (4S,5R)-4-[methoxy(methyl)carbamoyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CON(C)C(=O)[C@@H]1[C@@H](C)OC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26N2O5/c1-9-10(11(17)15(7)19-8)16(14(5,6)20-9)12(18)21-13(2,3)4/h9-10H,1-8H3/t9-,10+/m1/s1 |
| InChIKey | BSPFBCALJJTMAI-ZJUUUORDSA-N |
| XLogP | 1.77 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|