About 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline
4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline (PubChem CID 10017826) has the molecular formula C9H8BrClF3N
and a molecular weight of 302.52 g/mol. Its IUPAC name is 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline.
Molecular Properties
| Compound Name | 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline |
| PubChem CID | 10017826 |
| Molecular Formula | C9H8BrClF3N |
| Molecular Weight | 302.52 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline |
| SMILES | Cc1cc(C(F)(F)C(F)(Cl)Br)ccc1N |
| InChI | InChI=1S/C9H8BrClF3N/c1-5-4-6(2-3-7(5)15)8(12,13)9(10,11)14/h2-4H,15H2,1H3 |
| InChIKey | NRHDFRSTVILBAX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline?
The IUPAC name of 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline (CID 10017826) is 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline.
What is the SMILES notation for 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline?
The canonical SMILES for 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline is Cc1cc(C(F)(F)C(F)(Cl)Br)ccc1N.
What is the InChIKey of 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline?
The InChIKey is NRHDFRSTVILBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrClF3N/c1-5-4-6(2-3-7(5)15)8(12,13)9(10,11)14/h2-4H,15H2,1H3.
What are the key properties of 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline?
4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline has a molecular weight of 302.52 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromo-2-chloro-1,1,2-trifluoroethyl)-2-methylaniline is sourced from PubChem (CID 10017826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).