C16H13F2NOS — CID 10017966
6-(2,3-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione (PubChem CID 10017966) has the molecular formula C16H13F2NOS and a molecular weight of 305.35 g/mol. Its IUPAC name is 6-(2,3-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione.
| Compound Name | 6-(2,3-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione |
|---|---|
| PubChem CID | 10017966 |
| Molecular Formula | C16H13F2NOS |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 6-(2,3-difluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione |
| SMILES | CC1(C)OC(=S)Nc2ccc(-c3cccc(F)c3F)cc21 |
| InChI | InChI=1S/C16H13F2NOS/c1-16(2)11-8-9(6-7-13(11)19-15(21)20-16)10-4-3-5-12(17)14(10)18/h3-8H,1-2H3,(H,19,21) |
| InChIKey | WVQKUAAPNOSAJW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|