5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid

C16H12F2O4 — CID 10018008

IUPAC5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid
SMILESCCC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)O
InChIInChI=1S/C16H12F2O4/c1-2-15(19)22-14-6-3-9(7-12(14)16(20)21)11-5-4-10(17)8-13(11)18/h3-8H,2H2,1H3,(H,20,21)
InChIKeyCIFWYXJVMUGMTI-UHFFFAOYSA-N
MW306.26 g/mol
LogP3.65
Rot. Bonds4

About 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid

5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid (PubChem CID 10018008) has the molecular formula C16H12F2O4 and a molecular weight of 306.26 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid.

Molecular Properties

Compound Name5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid
PubChem CID10018008
Molecular FormulaC16H12F2O4
Molecular Weight306.26 g/mol
Exact Mass306.07
IUPAC Name5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid
SMILESCCC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)O
InChIInChI=1S/C16H12F2O4/c1-2-15(19)22-14-6-3-9(7-12(14)16(20)21)11-5-4-10(17)8-13(11)18/h3-8H,2H2,1H3,(H,20,21)
InChIKeyCIFWYXJVMUGMTI-UHFFFAOYSA-N
XLogP3.65
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.26
LogP ≤ 53.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid?
The IUPAC name of 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid (CID 10018008) is 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid.
What is the SMILES notation for 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid?
The canonical SMILES for 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid is CCC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)O.
What is the InChIKey of 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid?
The InChIKey is CIFWYXJVMUGMTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2O4/c1-2-15(19)22-14-6-3-9(7-12(14)16(20)21)11-5-4-10(17)8-13(11)18/h3-8H,2H2,1H3,(H,20,21).
What are the key properties of 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid?
5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid has a molecular weight of 306.26 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-difluorophenyl)-2-propanoyloxybenzoic acid is sourced from PubChem (CID 10018008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).