C20H34O2 — CID 10018055
(2E,6E,10E,12S)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-1,12-diol (PubChem CID 10018055) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (2E,6E,10E,12S)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-1,12-diol.
| Compound Name | (2E,6E,10E,12S)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-1,12-diol |
|---|---|
| PubChem CID | 10018055 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (2E,6E,10E,12S)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-1,12-diol |
| SMILES | CC(C)=CC[C@H](O)/C(C)=C/CC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C20H34O2/c1-16(2)12-13-20(22)19(5)11-7-10-17(3)8-6-9-18(4)14-15-21/h8,11-12,14,20-22H,6-7,9-10,13,15H2,1-5H3/b17-8+,18-14+,19-11+/t20-/m0/s1 |
| InChIKey | CHBFGYKXOFQFQP-UGGRNDNRSA-N |
| XLogP | 5.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|