C18H32O2Si — CID 10018163
tert-butyl-[[(1S,4R,6S)-3-methoxy-4-prop-2-enyl-1-bicyclo[4.1.0]hept-2-enyl]methoxy]-dimethylsilane (PubChem CID 10018163) has the molecular formula C18H32O2Si and a molecular weight of 308.54 g/mol. Its IUPAC name is tert-butyl-[[(1S,4R,6S)-3-methoxy-4-prop-2-enyl-1-bicyclo[4.1.0]hept-2-enyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,4R,6S)-3-methoxy-4-prop-2-enyl-1-bicyclo[4.1.0]hept-2-enyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10018163 |
| Molecular Formula | C18H32O2Si |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | tert-butyl-[[(1S,4R,6S)-3-methoxy-4-prop-2-enyl-1-bicyclo[4.1.0]hept-2-enyl]methoxy]-dimethylsilane |
| SMILES | C=CC[C@@H]1C[C@H]2C[C@@]2(CO[Si](C)(C)C(C)(C)C)C=C1OC |
| InChI | InChI=1S/C18H32O2Si/c1-8-9-14-10-15-11-18(15,12-16(14)19-5)13-20-21(6,7)17(2,3)4/h8,12,14-15H,1,9-11,13H2,2-7H3/t14-,15+,18+/m1/s1 |
| InChIKey | ZHNGWNLQSAJIOP-VKJFTORMSA-N |
| XLogP | 5.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|