C11H20O6P2 — CID 10018240
[(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-phosphonooxyphosphinic acid (PubChem CID 10018240) has the molecular formula C11H20O6P2 and a molecular weight of 310.22 g/mol. Its IUPAC name is [(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-phosphonooxyphosphinic acid.
| Compound Name | [(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-phosphonooxyphosphinic acid |
|---|---|
| PubChem CID | 10018240 |
| Molecular Formula | C11H20O6P2 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | [(1E,3E)-4,8-dimethylnona-1,3,7-trienyl]-phosphonooxyphosphinic acid |
| SMILES | CC(C)=CCC/C(C)=C/C=C/P(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C11H20O6P2/c1-10(2)6-4-7-11(3)8-5-9-18(12,13)17-19(14,15)16/h5-6,8-9H,4,7H2,1-3H3,(H,12,13)(H2,14,15,16)/b9-5+,11-8+ |
| InChIKey | DNXAQKFAAYIAMW-NBBRJXQPSA-N |
| XLogP | 3.49 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|