About 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine
5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine (PubChem CID 10018284) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine.
Molecular Properties
| Compound Name | 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine |
| PubChem CID | 10018284 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine |
| SMILES | c1ccc(C2CN(CN3COC(c4ccccc4)C3)CO2)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-3-7-16(8-4-1)18-11-20(14-22-18)13-21-12-19(23-15-21)17-9-5-2-6-10-17/h1-10,18-19H,11-15H2 |
| InChIKey | RSGMKOPZACAHQM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
The IUPAC name of 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine (CID 10018284) is 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine.
What is the SMILES notation for 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
The canonical SMILES for 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine is c1ccc(C2CN(CN3COC(c4ccccc4)C3)CO2)cc1.
What is the InChIKey of 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
The InChIKey is RSGMKOPZACAHQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2/c1-3-7-16(8-4-1)18-11-20(14-22-18)13-21-12-19(23-15-21)17-9-5-2-6-10-17/h1-10,18-19H,11-15H2.
What are the key properties of 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine?
5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine has a molecular weight of 310.40 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-3-[(5-phenyl-1,3-oxazolidin-3-yl)methyl]-1,3-oxazolidine is sourced from PubChem (CID 10018284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).