About 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid
2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid (PubChem CID 10018336) has the molecular formula C13H13NO6S
and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid.
Molecular Properties
| Compound Name | 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid |
| PubChem CID | 10018336 |
| Molecular Formula | C13H13NO6S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid |
| SMILES | CC(=O)Nc1csc2c1CCC(C(C(=O)O)C(=O)O)C2=O |
| InChI | InChI=1S/C13H13NO6S/c1-5(15)14-8-4-21-11-6(8)2-3-7(10(11)16)9(12(17)18)13(19)20/h4,7,9H,2-3H2,1H3,(H,14,15)(H,17,18)(H,19,20) |
| InChIKey | OAYIWFKMUZHYPD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid?
The IUPAC name of 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid (CID 10018336) is 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid.
What is the SMILES notation for 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid?
The canonical SMILES for 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid is CC(=O)Nc1csc2c1CCC(C(C(=O)O)C(=O)O)C2=O.
What is the InChIKey of 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid?
The InChIKey is OAYIWFKMUZHYPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO6S/c1-5(15)14-8-4-21-11-6(8)2-3-7(10(11)16)9(12(17)18)13(19)20/h4,7,9H,2-3H2,1H3,(H,14,15)(H,17,18)(H,19,20).
What are the key properties of 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid?
2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid has a molecular weight of 311.32 g/mol, XLogP of 1.24, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-acetamido-7-oxo-5,6-dihydro-4H-1-benzothiophen-6-yl)propanedioic acid is sourced from PubChem (CID 10018336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).