C14H20N2O4S — CID 10018407
2-[(4-methylsulfanyl-2-oxo-5,6,7,8-tetrahydroquinazolin-1-yl)methoxy]ethyl acetate (PubChem CID 10018407) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-[(4-methylsulfanyl-2-oxo-5,6,7,8-tetrahydroquinazolin-1-yl)methoxy]ethyl acetate.
| Compound Name | 2-[(4-methylsulfanyl-2-oxo-5,6,7,8-tetrahydroquinazolin-1-yl)methoxy]ethyl acetate |
|---|---|
| PubChem CID | 10018407 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-[(4-methylsulfanyl-2-oxo-5,6,7,8-tetrahydroquinazolin-1-yl)methoxy]ethyl acetate |
| SMILES | CSc1nc(=O)n(COCCOC(C)=O)c2c1CCCC2 |
| InChI | InChI=1S/C14H20N2O4S/c1-10(17)20-8-7-19-9-16-12-6-4-3-5-11(12)13(21-2)15-14(16)18/h3-9H2,1-2H3 |
| InChIKey | VTNDLALSXYNFKD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|