About 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine
5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine (PubChem CID 10018969) has the molecular formula C19H13F2N3
and a molecular weight of 321.33 g/mol. Its IUPAC name is 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine |
| PubChem CID | 10018969 |
| Molecular Formula | C19H13F2N3 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine |
| SMILES | Fc1cccc(F)c1Cn1ccc2nc(-c3ccccc3)nc-2c1 |
| InChI | InChI=1S/C19H13F2N3/c20-15-7-4-8-16(21)14(15)11-24-10-9-17-18(12-24)23-19(22-17)13-5-2-1-3-6-13/h1-10,12H,11H2 |
| InChIKey | RFJYGZURQRXYKL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine?
The IUPAC name of 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine (CID 10018969) is 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine.
What is the SMILES notation for 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine?
The canonical SMILES for 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine is Fc1cccc(F)c1Cn1ccc2nc(-c3ccccc3)nc-2c1.
What is the InChIKey of 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine?
The InChIKey is RFJYGZURQRXYKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2N3/c20-15-7-4-8-16(21)14(15)11-24-10-9-17-18(12-24)23-19(22-17)13-5-2-1-3-6-13/h1-10,12H,11H2.
What are the key properties of 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine?
5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine has a molecular weight of 321.33 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,6-difluorophenyl)methyl]-2-phenylimidazo[4,5-c]pyridine is sourced from PubChem (CID 10018969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).