C19H23N3O2 — CID 10019225
5-methyl-6-phenyl-1,3-dipropylpyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 10019225) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 5-methyl-6-phenyl-1,3-dipropylpyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-6-phenyl-1,3-dipropylpyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10019225 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 5-methyl-6-phenyl-1,3-dipropylpyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | CCCn1c(=O)c2c(cc(-c3ccccc3)n2C)n(CCC)c1=O |
| InChI | InChI=1S/C19H23N3O2/c1-4-11-21-16-13-15(14-9-7-6-8-10-14)20(3)17(16)18(23)22(12-5-2)19(21)24/h6-10,13H,4-5,11-12H2,1-3H3 |
| InChIKey | QCHFZZNUSGPSNK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |