C19H23N3O2 — CID 10019226
N-(1,4-dimethoxyacridin-9-yl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 10019226) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-(1,4-dimethoxyacridin-9-yl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(1,4-dimethoxyacridin-9-yl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 10019226 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-(1,4-dimethoxyacridin-9-yl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | COc1ccc(OC)c2c(NCCN(C)C)c3ccccc3nc12 |
| InChI | InChI=1S/C19H23N3O2/c1-22(2)12-11-20-18-13-7-5-6-8-14(13)21-19-16(24-4)10-9-15(23-3)17(18)19/h5-10H,11-12H2,1-4H3,(H,20,21) |
| InChIKey | LBCCGLOPIUVKJN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|