About [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate
[2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate (PubChem CID 10019488) has the molecular formula C9H7ClF3N3O3S
and a molecular weight of 329.69 g/mol. Its IUPAC name is [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate |
| PubChem CID | 10019488 |
| Molecular Formula | C9H7ClF3N3O3S |
| Molecular Weight | 329.69 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate |
| SMILES | CSc1nc(Cl)cc(NCC(=O)OC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C9H7ClF3N3O3S/c1-20-8-15-4(10)2-5(16-8)14-3-6(17)19-7(18)9(11,12)13/h2H,3H2,1H3,(H,14,15,16) |
| InChIKey | HPKZFHPCJRSHGP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.69 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate?
The IUPAC name of [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate (CID 10019488) is [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate?
The canonical SMILES for [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate is CSc1nc(Cl)cc(NCC(=O)OC(=O)C(F)(F)F)n1.
What is the InChIKey of [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate?
The InChIKey is HPKZFHPCJRSHGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClF3N3O3S/c1-20-8-15-4(10)2-5(16-8)14-3-6(17)19-7(18)9(11,12)13/h2H,3H2,1H3,(H,14,15,16).
What are the key properties of [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate?
[2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate has a molecular weight of 329.69 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(6-chloro-2-methylsulfanylpyrimidin-4-yl)amino]acetyl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 10019488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).