C9H4Cl2F7N — CID 10019496
2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline (PubChem CID 10019496) has the molecular formula C9H4Cl2F7N and a molecular weight of 330.03 g/mol. Its IUPAC name is 2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline.
| Compound Name | 2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline |
|---|---|
| PubChem CID | 10019496 |
| Molecular Formula | C9H4Cl2F7N |
| Molecular Weight | 330.03 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | 2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)aniline |
| SMILES | Nc1c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H4Cl2F7N/c10-4-1-3(2-5(11)6(4)19)7(12,8(13,14)15)9(16,17)18/h1-2H,19H2 |
| InChIKey | NXWRKJGSRUCYEN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.03 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|