About (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene
(6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene (PubChem CID 10019504) has the molecular formula C19H17Cl2N
and a molecular weight of 330.26 g/mol. Its IUPAC name is (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene.
Molecular Properties
| Compound Name | (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene |
| PubChem CID | 10019504 |
| Molecular Formula | C19H17Cl2N |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene |
| SMILES | Clc1ccc(C2=CCN3CC2[C@H](c2ccc(Cl)cc2)C3)cc1 |
| InChI | InChI=1S/C19H17Cl2N/c20-15-5-1-13(2-6-15)17-9-10-22-11-18(19(17)12-22)14-3-7-16(21)8-4-14/h1-9,18-19H,10-12H2/t18-,19?/m0/s1 |
| InChIKey | NXBREODEOPAFAK-OYKVQYDMSA-N |
| XLogP | 5.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene?
The IUPAC name of (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene (CID 10019504) is (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene.
What is the SMILES notation for (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene?
The canonical SMILES for (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene is Clc1ccc(C2=CCN3CC2[C@H](c2ccc(Cl)cc2)C3)cc1.
What is the InChIKey of (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene?
The InChIKey is NXBREODEOPAFAK-OYKVQYDMSA-N. The full InChI is InChI=1S/C19H17Cl2N/c20-15-5-1-13(2-6-15)17-9-10-22-11-18(19(17)12-22)14-3-7-16(21)8-4-14/h1-9,18-19H,10-12H2/t18-,19?/m0/s1.
What are the key properties of (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene?
(6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene has a molecular weight of 330.26 g/mol, XLogP of 5.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-4,6-bis(4-chlorophenyl)-1-azabicyclo[3.2.1]oct-3-ene is sourced from PubChem (CID 10019504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).