C10H9F5N2O3S — CID 10019627
N-(2,2,3,3,3-pentafluoropropyl)-4-sulfamoylbenzamide (PubChem CID 10019627) has the molecular formula C10H9F5N2O3S and a molecular weight of 332.25 g/mol. Its IUPAC name is N-(2,2,3,3,3-pentafluoropropyl)-4-sulfamoylbenzamide.
| Compound Name | N-(2,2,3,3,3-pentafluoropropyl)-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 10019627 |
| Molecular Formula | C10H9F5N2O3S |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | N-(2,2,3,3,3-pentafluoropropyl)-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H9F5N2O3S/c11-9(12,10(13,14)15)5-17-8(18)6-1-3-7(4-2-6)21(16,19)20/h1-4H,5H2,(H,17,18)(H2,16,19,20) |
| InChIKey | XRWFNUPDTKOWTL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|