About 5-phenylimidazolidine-2,4-dione
5-phenylimidazolidine-2,4-dione (PubChem CID 1002) has the molecular formula C9H8N2O2
and a molecular weight of 176.18 g/mol. Its IUPAC name is 5-phenylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-phenylimidazolidine-2,4-dione |
| PubChem CID | 1002 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccccc2)N1 |
| InChI | InChI=1S/C9H8N2O2/c12-8-7(10-9(13)11-8)6-4-2-1-3-5-6/h1-5,7H,(H2,10,11,12,13) |
| InChIKey | NXQJDVBMMRCKQG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylimidazolidine-2,4-dione?
The IUPAC name of 5-phenylimidazolidine-2,4-dione (CID 1002) is 5-phenylimidazolidine-2,4-dione.
What is the SMILES notation for 5-phenylimidazolidine-2,4-dione?
The canonical SMILES for 5-phenylimidazolidine-2,4-dione is O=C1NC(=O)C(c2ccccc2)N1.
What is the InChIKey of 5-phenylimidazolidine-2,4-dione?
The InChIKey is NXQJDVBMMRCKQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-8-7(10-9(13)11-8)6-4-2-1-3-5-6/h1-5,7H,(H2,10,11,12,13).
What are the key properties of 5-phenylimidazolidine-2,4-dione?
5-phenylimidazolidine-2,4-dione has a molecular weight of 176.18 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylimidazolidine-2,4-dione is sourced from PubChem (CID 1002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).