C14H28O5P2 — CID 10020005
[(5E)-1-[hydroxy(methyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid (PubChem CID 10020005) has the molecular formula C14H28O5P2 and a molecular weight of 338.32 g/mol. Its IUPAC name is [(5E)-1-[hydroxy(methyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid.
| Compound Name | [(5E)-1-[hydroxy(methyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10020005 |
| Molecular Formula | C14H28O5P2 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(5E)-1-[hydroxy(methyl)phosphoryl]-6,10-dimethylundeca-5,9-dienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CCCC(P(C)(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C14H28O5P2/c1-12(2)8-7-10-13(3)9-5-6-11-14(20(4,15)16)21(17,18)19/h8-9,14H,5-7,10-11H2,1-4H3,(H,15,16)(H2,17,18,19)/b13-9+ |
| InChIKey | PNXHNOHUDILHSH-UKTHLTGXSA-N |
| XLogP | 4.25 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|