C16H12ClN3O4 — CID 10020472
2-[(7-chloro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]benzoic acid (PubChem CID 10020472) has the molecular formula C16H12ClN3O4 and a molecular weight of 345.74 g/mol. Its IUPAC name is 2-[(7-chloro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]benzoic acid.
| Compound Name | 2-[(7-chloro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 10020472 |
| Molecular Formula | C16H12ClN3O4 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-[(7-chloro-2,3-dioxo-1,4-dihydroquinoxalin-5-yl)methylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NCc1cc(Cl)cc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C16H12ClN3O4/c17-9-5-8(13-12(6-9)19-14(21)15(22)20-13)7-18-11-4-2-1-3-10(11)16(23)24/h1-6,18H,7H2,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | JEDNBGQTGZWNTC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|