About 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole
4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole (PubChem CID 10020588) has the molecular formula C18H18FNO3S
and a molecular weight of 347.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole |
| PubChem CID | 10020588 |
| Molecular Formula | C18H18FNO3S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole |
| SMILES | CC1C(c2ccc(F)cc2)=C(c2ccc(S(C)(=O)=O)cc2)ON1C |
| InChI | InChI=1S/C18H18FNO3S/c1-12-17(13-4-8-15(19)9-5-13)18(23-20(12)2)14-6-10-16(11-7-14)24(3,21)22/h4-12H,1-3H3 |
| InChIKey | CARDZWUJKAFXIX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole?
The IUPAC name of 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole (CID 10020588) is 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole.
What is the SMILES notation for 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole?
The canonical SMILES for 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole is CC1C(c2ccc(F)cc2)=C(c2ccc(S(C)(=O)=O)cc2)ON1C.
What is the InChIKey of 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole?
The InChIKey is CARDZWUJKAFXIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FNO3S/c1-12-17(13-4-8-15(19)9-5-13)18(23-20(12)2)14-6-10-16(11-7-14)24(3,21)22/h4-12H,1-3H3.
What are the key properties of 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole?
4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole has a molecular weight of 347.41 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-2,3-dimethyl-5-(4-methylsulfonylphenyl)-3H-1,2-oxazole is sourced from PubChem (CID 10020588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).