C19H25NO5 — CID 10020589
[(9S,10R,13S,14S)-10-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl nitrate (PubChem CID 10020589) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is [(9S,10R,13S,14S)-10-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl nitrate.
| Compound Name | [(9S,10R,13S,14S)-10-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl nitrate |
|---|---|
| PubChem CID | 10020589 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | [(9S,10R,13S,14S)-10-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-13-yl]methyl nitrate |
| SMILES | C[C@]12CCC(=O)C=C1CCC1[C@@H]3CCC(=O)[C@@]3(CO[N+](=O)[O-])CC[C@@H]12 |
| InChI | InChI=1S/C19H25NO5/c1-18-8-6-13(21)10-12(18)2-3-14-15(18)7-9-19(11-25-20(23)24)16(14)4-5-17(19)22/h10,14-16H,2-9,11H2,1H3/t14?,15-,16-,18-,19+/m0/s1 |
| InChIKey | HYLWIMFIIFLNCA-PVZMZQEOSA-N |
| XLogP | 3.28 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|