About 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline
2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline (PubChem CID 10020722) has the molecular formula C22H20FNO2
and a molecular weight of 349.40 g/mol. Its IUPAC name is 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline.
Molecular Properties
| Compound Name | 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline |
| PubChem CID | 10020722 |
| Molecular Formula | C22H20FNO2 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline |
| SMILES | Fc1ccc(-c2c(C3OCCCO3)c(C3CC3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C22H20FNO2/c23-16-10-8-14(9-11-16)19-17-4-1-2-5-18(17)24-21(15-6-7-15)20(19)22-25-12-3-13-26-22/h1-2,4-5,8-11,15,22H,3,6-7,12-13H2 |
| InChIKey | JBOVRQQTLGTNNS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline?
The IUPAC name of 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline (CID 10020722) is 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline.
What is the SMILES notation for 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline?
The canonical SMILES for 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline is Fc1ccc(-c2c(C3OCCCO3)c(C3CC3)nc3ccccc23)cc1.
What is the InChIKey of 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline?
The InChIKey is JBOVRQQTLGTNNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20FNO2/c23-16-10-8-14(9-11-16)19-17-4-1-2-5-18(17)24-21(15-6-7-15)20(19)22-25-12-3-13-26-22/h1-2,4-5,8-11,15,22H,3,6-7,12-13H2.
What are the key properties of 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline?
2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline has a molecular weight of 349.40 g/mol, XLogP of 5.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-3-(1,3-dioxan-2-yl)-4-(4-fluorophenyl)quinoline is sourced from PubChem (CID 10020722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).