C8H14Br2O3S — CID 10020755
(3S,5R)-3-(bromomethyl)-5-(2-bromopropan-2-yl)-1,4-oxathiane 4,4-dioxide (PubChem CID 10020755) has the molecular formula C8H14Br2O3S and a molecular weight of 350.07 g/mol. Its IUPAC name is (3S,5R)-3-(bromomethyl)-5-(2-bromopropan-2-yl)-1,4-oxathiane 4,4-dioxide.
| Compound Name | (3S,5R)-3-(bromomethyl)-5-(2-bromopropan-2-yl)-1,4-oxathiane 4,4-dioxide |
|---|---|
| PubChem CID | 10020755 |
| Molecular Formula | C8H14Br2O3S |
| Molecular Weight | 350.07 g/mol |
| Exact Mass | 347.90 |
| IUPAC Name | (3S,5R)-3-(bromomethyl)-5-(2-bromopropan-2-yl)-1,4-oxathiane 4,4-dioxide |
| SMILES | CC(C)(Br)[C@H]1COC[C@@H](CBr)S1(=O)=O |
| InChI | InChI=1S/C8H14Br2O3S/c1-8(2,10)7-5-13-4-6(3-9)14(7,11)12/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | DVAYNIYBQPANNT-RNFRBKRXSA-N |
| XLogP | 1.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.07 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|