C22H25NO3 — CID 10020849
(1R)-1-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]-1-hydroxy-4,4-dimethylpentan-3-one (PubChem CID 10020849) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (1R)-1-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]-1-hydroxy-4,4-dimethylpentan-3-one.
| Compound Name | (1R)-1-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]-1-hydroxy-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 10020849 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | (1R)-1-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]-1-hydroxy-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)C[C@@H](O)C1=NO[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H25NO3/c1-22(2,3)18(25)14-17(24)20-19(15-10-6-4-7-11-15)21(26-23-20)16-12-8-5-9-13-16/h4-13,17,19,21,24H,14H2,1-3H3/t17-,19+,21-/m1/s1 |
| InChIKey | QESSVNNSJZQMTI-SLYNCCJLSA-N |
| XLogP | 4.26 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |