C23H30O3 — CID 10021040
(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-4-prop-2-enylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid (PubChem CID 10021040) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-4-prop-2-enylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-4-prop-2-enylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 10021040 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxo-4-prop-2-enylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid |
| SMILES | C=CCC1CC(C)(C)C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C23H30O3/c1-7-9-19-15-23(5,6)20(18(4)22(19)26)13-12-16(2)10-8-11-17(3)14-21(24)25/h7-8,10-14,19H,1,9,15H2,2-6H3,(H,24,25)/b11-8+,13-12+,16-10+,17-14+ |
| InChIKey | RSBMBCFAQZUHFQ-WORGIYGOSA-N |
| XLogP | 5.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|