C21H27NO2S — CID 10021256
(4aS,8aS)-6-[1-isocyano-1-(4-methylphenyl)sulfonylethyl]-8a-methyl-2,3,4,4a,7,8-hexahydro-1H-naphthalene (PubChem CID 10021256) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is (4aS,8aS)-6-[1-isocyano-1-(4-methylphenyl)sulfonylethyl]-8a-methyl-2,3,4,4a,7,8-hexahydro-1H-naphthalene.
| Compound Name | (4aS,8aS)-6-[1-isocyano-1-(4-methylphenyl)sulfonylethyl]-8a-methyl-2,3,4,4a,7,8-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 10021256 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (4aS,8aS)-6-[1-isocyano-1-(4-methylphenyl)sulfonylethyl]-8a-methyl-2,3,4,4a,7,8-hexahydro-1H-naphthalene |
| SMILES | [C-]#[N+]C(C)(C1=C[C@@H]2CCCC[C@@]2(C)CC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H27NO2S/c1-16-8-10-19(11-9-16)25(23,24)21(3,22-4)18-12-14-20(2)13-6-5-7-17(20)15-18/h8-11,15,17H,5-7,12-14H2,1-3H3/t17-,20-,21?/m0/s1 |
| InChIKey | DOGQZDHLHKQPLL-LTGDSAQFSA-N |
| XLogP | 5.32 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|