C23H21NO3 — CID 10021372
2-[2-methyl-6-[(E)-3-phenylprop-2-enoyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]acetic acid (PubChem CID 10021372) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[2-methyl-6-[(E)-3-phenylprop-2-enoyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]acetic acid.
| Compound Name | 2-[2-methyl-6-[(E)-3-phenylprop-2-enoyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]acetic acid |
|---|---|
| PubChem CID | 10021372 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[2-methyl-6-[(E)-3-phenylprop-2-enoyl]-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(C(=O)/C=C/c3ccccc3)cc3c2n1CCC3 |
| InChI | InChI=1S/C23H21NO3/c1-15-19(14-22(26)27)20-13-18(12-17-8-5-11-24(15)23(17)20)21(25)10-9-16-6-3-2-4-7-16/h2-4,6-7,9-10,12-13H,5,8,11,14H2,1H3,(H,26,27)/b10-9+ |
| InChIKey | QSXPRYAKPDHOTQ-MDZDMXLPSA-N |
| XLogP | 4.42 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|