About 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline
6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline (PubChem CID 10021634) has the molecular formula C24H29NO2
and a molecular weight of 363.50 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline.
Molecular Properties
| Compound Name | 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline |
| PubChem CID | 10021634 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline |
| SMILES | C=CCOC(CC)C1=CC(C)(C)Nc2ccc(-c3ccccc3OC)cc21 |
| InChI | InChI=1S/C24H29NO2/c1-6-14-27-22(7-2)20-16-24(3,4)25-21-13-12-17(15-19(20)21)18-10-8-9-11-23(18)26-5/h6,8-13,15-16,22,25H,1,7,14H2,2-5H3 |
| InChIKey | JJBGOTRJBHAAQW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline?
The IUPAC name of 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline (CID 10021634) is 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline.
What is the SMILES notation for 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline?
The canonical SMILES for 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline is C=CCOC(CC)C1=CC(C)(C)Nc2ccc(-c3ccccc3OC)cc21.
What is the InChIKey of 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline?
The InChIKey is JJBGOTRJBHAAQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO2/c1-6-14-27-22(7-2)20-16-24(3,4)25-21-13-12-17(15-19(20)21)18-10-8-9-11-23(18)26-5/h6,8-13,15-16,22,25H,1,7,14H2,2-5H3.
What are the key properties of 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline?
6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline has a molecular weight of 363.50 g/mol, XLogP of 5.93, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methoxyphenyl)-2,2-dimethyl-4-(1-prop-2-enoxypropyl)-1H-quinoline is sourced from PubChem (CID 10021634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).