C23H40O3 — CID 10021708
(4R,6S)-4-[(Z)-heptadec-10-enyl]-4,6-dihydroxycyclohex-2-en-1-one (PubChem CID 10021708) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is (4R,6S)-4-[(Z)-heptadec-10-enyl]-4,6-dihydroxycyclohex-2-en-1-one.
| Compound Name | (4R,6S)-4-[(Z)-heptadec-10-enyl]-4,6-dihydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10021708 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | (4R,6S)-4-[(Z)-heptadec-10-enyl]-4,6-dihydroxycyclohex-2-en-1-one |
| SMILES | CCCCCC/C=C\CCCCCCCCC[C@]1(O)C=CC(=O)[C@@H](O)C1 |
| InChI | InChI=1S/C23H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-23(26)19-17-21(24)22(25)20-23/h7-8,17,19,22,25-26H,2-6,9-16,18,20H2,1H3/b8-7-/t22-,23-/m0/s1 |
| InChIKey | QGMORWLDWJPVQC-CHXUTICSSA-N |
| XLogP | 5.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|