C17H21BrN2O2 — CID 10021730
2-(3-bromopropylamino)-9-methoxy-1,6,7,11b-tetrahydrobenzo[a]quinolizin-4-one (PubChem CID 10021730) has the molecular formula C17H21BrN2O2 and a molecular weight of 365.27 g/mol. Its IUPAC name is 2-(3-bromopropylamino)-9-methoxy-1,6,7,11b-tetrahydrobenzo[a]quinolizin-4-one.
| Compound Name | 2-(3-bromopropylamino)-9-methoxy-1,6,7,11b-tetrahydrobenzo[a]quinolizin-4-one |
|---|---|
| PubChem CID | 10021730 |
| Molecular Formula | C17H21BrN2O2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2-(3-bromopropylamino)-9-methoxy-1,6,7,11b-tetrahydrobenzo[a]quinolizin-4-one |
| SMILES | COc1ccc2c(c1)CCN1C(=O)C=C(NCCCBr)CC21 |
| InChI | InChI=1S/C17H21BrN2O2/c1-22-14-3-4-15-12(9-14)5-8-20-16(15)10-13(11-17(20)21)19-7-2-6-18/h3-4,9,11,16,19H,2,5-8,10H2,1H3 |
| InChIKey | QFKYULOXTLZSHK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|