About 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide
3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide (PubChem CID 10021978) has the molecular formula C17H18Cl2N2O3
and a molecular weight of 369.25 g/mol. Its IUPAC name is 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide.
Molecular Properties
| Compound Name | 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide |
| PubChem CID | 10021978 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide |
| SMILES | CCCCOc1cc(C(=O)Nc2c(Cl)cncc2Cl)ccc1OC |
| InChI | InChI=1S/C17H18Cl2N2O3/c1-3-4-7-24-15-8-11(5-6-14(15)23-2)17(22)21-16-12(18)9-20-10-13(16)19/h5-6,8-10H,3-4,7H2,1-2H3,(H,20,21,22) |
| InChIKey | AEVXMUCLERMJMB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide?
The IUPAC name of 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide (CID 10021978) is 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide.
What is the SMILES notation for 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide?
The canonical SMILES for 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide is CCCCOc1cc(C(=O)Nc2c(Cl)cncc2Cl)ccc1OC.
What is the InChIKey of 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide?
The InChIKey is AEVXMUCLERMJMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N2O3/c1-3-4-7-24-15-8-11(5-6-14(15)23-2)17(22)21-16-12(18)9-20-10-13(16)19/h5-6,8-10H,3-4,7H2,1-2H3,(H,20,21,22).
What are the key properties of 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide?
3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide has a molecular weight of 369.25 g/mol, XLogP of 4.83, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-N-(3,5-dichloro-4-pyridinyl)-4-methoxybenzamide is sourced from PubChem (CID 10021978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).