C23H32O4 — CID 10022181
(1S,4S,5R,8S,9R,12R,13R)-1,5-dimethyl-9-(3-phenylpropyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10022181) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1S,4S,5R,8S,9R,12R,13R)-1,5-dimethyl-9-(3-phenylpropyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,4S,5R,8S,9R,12R,13R)-1,5-dimethyl-9-(3-phenylpropyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10022181 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (1S,4S,5R,8S,9R,12R,13R)-1,5-dimethyl-9-(3-phenylpropyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](CCCc3ccccc3)CO[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C23H32O4/c1-16-11-12-20-18(10-6-9-17-7-4-3-5-8-17)15-24-21-23(20)19(16)13-14-22(2,25-21)26-27-23/h3-5,7-8,16,18-21H,6,9-15H2,1-2H3/t16-,18+,19+,20+,21-,22+,23-/m1/s1 |
| InChIKey | JEYREVQJWDNMSE-LVYCEBOYSA-N |
| XLogP | 4.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|