C10H20F4O6P2 — CID 10022267
1,2-bis(diethoxyphosphoryl)-1,1,2,2-tetrafluoroethane (PubChem CID 10022267) has the molecular formula C10H20F4O6P2 and a molecular weight of 374.20 g/mol. Its IUPAC name is 1,2-bis(diethoxyphosphoryl)-1,1,2,2-tetrafluoroethane.
| Compound Name | 1,2-bis(diethoxyphosphoryl)-1,1,2,2-tetrafluoroethane |
|---|---|
| PubChem CID | 10022267 |
| Molecular Formula | C10H20F4O6P2 |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 1,2-bis(diethoxyphosphoryl)-1,1,2,2-tetrafluoroethane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(F)(F)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H20F4O6P2/c1-5-17-21(15,18-6-2)9(11,12)10(13,14)22(16,19-7-3)20-8-4/h5-8H2,1-4H3 |
| InChIKey | VHKNCGJNEAVBNK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|