C20H18N6O2 — CID 10022281
1-(3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)-2-[(2-nitrophenyl)methyl]hydrazine (PubChem CID 10022281) has the molecular formula C20H18N6O2 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-(3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)-2-[(2-nitrophenyl)methyl]hydrazine.
| Compound Name | 1-(3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)-2-[(2-nitrophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 10022281 |
| Molecular Formula | C20H18N6O2 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-(3-methyl-1-phenylpyrazolo[3,4-b]pyridin-4-yl)-2-[(2-nitrophenyl)methyl]hydrazine |
| SMILES | Cc1nn(-c2ccccc2)c2nccc(NNCc3ccccc3[N+](=O)[O-])c12 |
| InChI | InChI=1S/C20H18N6O2/c1-14-19-17(23-22-13-15-7-5-6-10-18(15)26(27)28)11-12-21-20(19)25(24-14)16-8-3-2-4-9-16/h2-12,22H,13H2,1H3,(H,21,23) |
| InChIKey | RSWYKQNCPPNRRQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|