C24H40O3 — CID 10022435
2-hydroxyethyl (5Z,8Z,11Z,14Z)-2,2-dimethylicosa-5,8,11,14-tetraenoate (PubChem CID 10022435) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is 2-hydroxyethyl (5Z,8Z,11Z,14Z)-2,2-dimethylicosa-5,8,11,14-tetraenoate.
| Compound Name | 2-hydroxyethyl (5Z,8Z,11Z,14Z)-2,2-dimethylicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 10022435 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | 2-hydroxyethyl (5Z,8Z,11Z,14Z)-2,2-dimethylicosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCC(C)(C)C(=O)OCCO |
| InChI | InChI=1S/C24H40O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24(2,3)23(26)27-22-21-25/h8-9,11-12,14-15,17-18,25H,4-7,10,13,16,19-22H2,1-3H3/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | WJKSCUWBYPTSMN-GKFVBPDJSA-N |
| XLogP | 6.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|