C16H28O6P2 — CID 10022517
phosphonooxy-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphinic acid (PubChem CID 10022517) has the molecular formula C16H28O6P2 and a molecular weight of 378.34 g/mol. Its IUPAC name is phosphonooxy-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphinic acid.
| Compound Name | phosphonooxy-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphinic acid |
|---|---|
| PubChem CID | 10022517 |
| Molecular Formula | C16H28O6P2 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | phosphonooxy-[(1E,3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraenyl]phosphinic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/P(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C16H28O6P2/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-23(17,18)22-24(19,20)21/h7-8,10,12-13H,5-6,9,11H2,1-4H3,(H,17,18)(H2,19,20,21)/b13-7+,15-10+,16-12+ |
| InChIKey | JRKGWBWCYBDLRE-YKXWRRLFSA-N |
| XLogP | 5.21 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|