C16H25Cl2N3OS — CID 10022522
(2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-[(2,3-dichlorophenyl)methyl]-3-methylpentanamide (PubChem CID 10022522) has the molecular formula C16H25Cl2N3OS and a molecular weight of 378.37 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-[(2,3-dichlorophenyl)methyl]-3-methylpentanamide.
| Compound Name | (2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-[(2,3-dichlorophenyl)methyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 10022522 |
| Molecular Formula | C16H25Cl2N3OS |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (2S)-2-[[(2R)-2-amino-3-sulfanylpropyl]amino]-N-[(2,3-dichlorophenyl)methyl]-3-methylpentanamide |
| SMILES | CCC(C)[C@H](NC[C@@H](N)CS)C(=O)NCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H25Cl2N3OS/c1-3-10(2)15(20-8-12(19)9-23)16(22)21-7-11-5-4-6-13(17)14(11)18/h4-6,10,12,15,20,23H,3,7-9,19H2,1-2H3,(H,21,22)/t10?,12-,15+/m1/s1 |
| InChIKey | DGTFNAFXRTYEDI-KAPROSIYSA-N |
| XLogP | 2.87 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|