C17H17Cl2N3O3S — CID 1002254
2,5-dichloro-3-(2-morpholin-4-yl-1,3-thiazol-5-yl)-6-pyrrolidin-1-ylcyclohexa-2,5-diene-1,4-dione (PubChem CID 1002254) has the molecular formula C17H17Cl2N3O3S and a molecular weight of 414.31 g/mol. Its IUPAC name is 2,5-dichloro-3-(2-morpholin-4-yl-1,3-thiazol-5-yl)-6-pyrrolidin-1-ylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dichloro-3-(2-morpholin-4-yl-1,3-thiazol-5-yl)-6-pyrrolidin-1-ylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 1002254 |
| Molecular Formula | C17H17Cl2N3O3S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 2,5-dichloro-3-(2-morpholin-4-yl-1,3-thiazol-5-yl)-6-pyrrolidin-1-ylcyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(Cl)=C(N2CCCC2)C(=O)C(Cl)=C1c1cnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C17H17Cl2N3O3S/c18-12-11(10-9-20-17(26-10)22-5-7-25-8-6-22)15(23)13(19)14(16(12)24)21-3-1-2-4-21/h9H,1-8H2 |
| InChIKey | IKYGSDRHYXTDFC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|