C17H15ClN2O6 — CID 10022579
ethyl 2-(7-chloro-10,11-dimethoxy-3,4-dioxo-2,8-diazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-yl)acetate (PubChem CID 10022579) has the molecular formula C17H15ClN2O6 and a molecular weight of 378.77 g/mol. Its IUPAC name is ethyl 2-(7-chloro-10,11-dimethoxy-3,4-dioxo-2,8-diazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-yl)acetate.
| Compound Name | ethyl 2-(7-chloro-10,11-dimethoxy-3,4-dioxo-2,8-diazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-yl)acetate |
|---|---|
| PubChem CID | 10022579 |
| Molecular Formula | C17H15ClN2O6 |
| Molecular Weight | 378.77 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | ethyl 2-(7-chloro-10,11-dimethoxy-3,4-dioxo-2,8-diazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-2-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)C(=O)c2cc(Cl)nc3c(OC)c(OC)cc1c23 |
| InChI | InChI=1S/C17H15ClN2O6/c1-4-26-12(21)7-20-9-6-10(24-2)16(25-3)14-13(9)8(5-11(18)19-14)15(22)17(20)23/h5-6H,4,7H2,1-3H3 |
| InChIKey | GLLSVQOWPUACKS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.77 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|