About 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile
4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile (PubChem CID 10022796) has the molecular formula C26H26N2O
and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile |
| PubChem CID | 10022796 |
| Molecular Formula | C26H26N2O |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN[C@@H]2CC[C@H](C(c3ccccc3)c3ccccc3)OC2)cc1 |
| InChI | InChI=1S/C26H26N2O/c27-17-20-11-13-21(14-12-20)18-28-24-15-16-25(29-19-24)26(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,24-26,28H,15-16,18-19H2/t24-,25-/m1/s1 |
| InChIKey | HBTXMEWTLQYGBO-JWQCQUIFSA-N |
| XLogP | 5.03 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile?
The IUPAC name of 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile (CID 10022796) is 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile.
What is the SMILES notation for 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile?
The canonical SMILES for 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile is N#Cc1ccc(CN[C@@H]2CC[C@H](C(c3ccccc3)c3ccccc3)OC2)cc1.
What is the InChIKey of 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile?
The InChIKey is HBTXMEWTLQYGBO-JWQCQUIFSA-N. The full InChI is InChI=1S/C26H26N2O/c27-17-20-11-13-21(14-12-20)18-28-24-15-16-25(29-19-24)26(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-14,24-26,28H,15-16,18-19H2/t24-,25-/m1/s1.
What are the key properties of 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile?
4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile has a molecular weight of 382.51 g/mol, XLogP of 5.03, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[(3R,6R)-6-benzhydryloxan-3-yl]amino]methyl]benzonitrile is sourced from PubChem (CID 10022796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).